C17H23NO9S — CID 146335870
ethyl 3-(3-methoxysulfonylpropanoyloxy)-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 146335870) has the molecular formula C17H23NO9S and a molecular weight of 417.44 g/mol. Its IUPAC name is ethyl 3-(3-methoxysulfonylpropanoyloxy)-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | ethyl 3-(3-methoxysulfonylpropanoyloxy)-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 146335870 |
| Molecular Formula | C17H23NO9S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | ethyl 3-(3-methoxysulfonylpropanoyloxy)-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CCOC(=O)C(COC(=O)CCS(=O)(=O)OC)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO9S/c1-3-25-16(20)14(12-26-15(19)9-10-28(22,23)24-2)18-17(21)27-11-13-7-5-4-6-8-13/h4-8,14H,3,9-12H2,1-2H3,(H,18,21) |
| InChIKey | QGHXBDBSXOYKEQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|