C20H21N3O4 — CID 146337624
cyanomethyl (2S)-2-[(4-aminophenyl)methoxycarbonylamino]-4-phenylbutanoate (PubChem CID 146337624) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is cyanomethyl (2S)-2-[(4-aminophenyl)methoxycarbonylamino]-4-phenylbutanoate.
| Compound Name | cyanomethyl (2S)-2-[(4-aminophenyl)methoxycarbonylamino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 146337624 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | cyanomethyl (2S)-2-[(4-aminophenyl)methoxycarbonylamino]-4-phenylbutanoate |
| SMILES | N#CCOC(=O)[C@H](CCc1ccccc1)NC(=O)OCc1ccc(N)cc1 |
| InChI | InChI=1S/C20H21N3O4/c21-12-13-26-19(24)18(11-8-15-4-2-1-3-5-15)23-20(25)27-14-16-6-9-17(22)10-7-16/h1-7,9-10,18H,8,11,13-14,22H2,(H,23,25)/t18-/m0/s1 |
| InChIKey | MMBKVSRJVXUZEQ-SFHVURJKSA-N |
| XLogP | 2.56 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|