About [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol
[(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol (PubChem CID 146339303) has the molecular formula C10H19F2NO3
and a molecular weight of 239.26 g/mol. Its IUPAC name is [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol.
Molecular Properties
| Compound Name | [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol |
| PubChem CID | 146339303 |
| Molecular Formula | C10H19F2NO3 |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol |
| SMILES | CC(C)(C)OC(O)NC1CCCOC1(F)F |
| InChI | InChI=1S/C10H19F2NO3/c1-9(2,3)16-8(14)13-7-5-4-6-15-10(7,11)12/h7-8,13-14H,4-6H2,1-3H3 |
| InChIKey | IVQWAZSXUKFQOJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol?
The IUPAC name of [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol (CID 146339303) is [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol.
What is the SMILES notation for [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol?
The canonical SMILES for [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol is CC(C)(C)OC(O)NC1CCCOC1(F)F.
What is the InChIKey of [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol?
The InChIKey is IVQWAZSXUKFQOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F2NO3/c1-9(2,3)16-8(14)13-7-5-4-6-15-10(7,11)12/h7-8,13-14H,4-6H2,1-3H3.
What are the key properties of [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol?
[(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol has a molecular weight of 239.26 g/mol, XLogP of 1.44, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol is sourced from PubChem (CID 146339303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).