C10H19F2NO3 — CID 146339303
[(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol (PubChem CID 146339303) has the molecular formula C10H19F2NO3 and a molecular weight of 239.26 g/mol. Its IUPAC name is [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol.
| Compound Name | [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol |
|---|---|
| PubChem CID | 146339303 |
| Molecular Formula | C10H19F2NO3 |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | [(2,2-difluorooxan-3-yl)amino]-[(2-methylpropan-2-yl)oxy]methanol |
| SMILES | CC(C)(C)OC(O)NC1CCCOC1(F)F |
| InChI | InChI=1S/C10H19F2NO3/c1-9(2,3)16-8(14)13-7-5-4-6-15-10(7,11)12/h7-8,13-14H,4-6H2,1-3H3 |
| InChIKey | IVQWAZSXUKFQOJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|