About [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol
[[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol (PubChem CID 69284526) has the molecular formula C11H21F2NO2
and a molecular weight of 237.29 g/mol. Its IUPAC name is [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol.
Molecular Properties
| Compound Name | [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol |
| PubChem CID | 69284526 |
| Molecular Formula | C11H21F2NO2 |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol |
| SMILES | CC(C)(C)OC(O)N[C@@H]1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H21F2NO2/c1-10(2,3)16-9(15)14-8-5-4-6-11(12,13)7-8/h8-9,14-15H,4-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | FSJJPOHZCKDPOO-VEDVMXKPSA-N |
| XLogP | 2.24 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol?
The IUPAC name of [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol (CID 69284526) is [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol.
What is the SMILES notation for [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol?
The canonical SMILES for [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol is CC(C)(C)OC(O)N[C@@H]1CCCC(F)(F)C1.
What is the InChIKey of [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol?
The InChIKey is FSJJPOHZCKDPOO-VEDVMXKPSA-N. The full InChI is InChI=1S/C11H21F2NO2/c1-10(2,3)16-9(15)14-8-5-4-6-11(12,13)7-8/h8-9,14-15H,4-7H2,1-3H3/t8-,9?/m1/s1.
What are the key properties of [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol?
[[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol has a molecular weight of 237.29 g/mol, XLogP of 2.24, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol is sourced from PubChem (CID 69284526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).