C11H21F2NO2 — CID 69284526
[[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol (PubChem CID 69284526) has the molecular formula C11H21F2NO2 and a molecular weight of 237.29 g/mol. Its IUPAC name is [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol.
| Compound Name | [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol |
|---|---|
| PubChem CID | 69284526 |
| Molecular Formula | C11H21F2NO2 |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | [[(1R)-3,3-difluorocyclohexyl]amino]-[(2-methylpropan-2-yl)oxy]methanol |
| SMILES | CC(C)(C)OC(O)N[C@@H]1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H21F2NO2/c1-10(2,3)16-9(15)14-8-5-4-6-11(12,13)7-8/h8-9,14-15H,4-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | FSJJPOHZCKDPOO-VEDVMXKPSA-N |
| XLogP | 2.24 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|