C22H20ClN3O2 — CID 146339585
2-[[7-(2-chloro-3-phenylanilino)furo[2,3-c]pyridin-3-yl]methylamino]ethanol (PubChem CID 146339585) has the molecular formula C22H20ClN3O2 and a molecular weight of 393.87 g/mol. Its IUPAC name is 2-[[7-(2-chloro-3-phenylanilino)furo[2,3-c]pyridin-3-yl]methylamino]ethanol.
| Compound Name | 2-[[7-(2-chloro-3-phenylanilino)furo[2,3-c]pyridin-3-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 146339585 |
| Molecular Formula | C22H20ClN3O2 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 2-[[7-(2-chloro-3-phenylanilino)furo[2,3-c]pyridin-3-yl]methylamino]ethanol |
| SMILES | OCCNCc1coc2c(Nc3cccc(-c4ccccc4)c3Cl)nccc12 |
| InChI | InChI=1S/C22H20ClN3O2/c23-20-17(15-5-2-1-3-6-15)7-4-8-19(20)26-22-21-18(9-10-25-22)16(14-28-21)13-24-11-12-27/h1-10,14,24,27H,11-13H2,(H,25,26) |
| InChIKey | BHFDHZICHXTFHJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|