C22H21ClN4S — CID 163732796
N-(2-chloro-3-phenylphenyl)-2-(propylaminomethyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine (PubChem CID 163732796) has the molecular formula C22H21ClN4S and a molecular weight of 408.96 g/mol. Its IUPAC name is N-(2-chloro-3-phenylphenyl)-2-(propylaminomethyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine.
| Compound Name | N-(2-chloro-3-phenylphenyl)-2-(propylaminomethyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine |
|---|---|
| PubChem CID | 163732796 |
| Molecular Formula | C22H21ClN4S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-(2-chloro-3-phenylphenyl)-2-(propylaminomethyl)-[1,3]thiazolo[5,4-c]pyridin-4-amine |
| SMILES | CCCNCc1nc2ccnc(Nc3cccc(-c4ccccc4)c3Cl)c2s1 |
| InChI | InChI=1S/C22H21ClN4S/c1-2-12-24-14-19-26-18-11-13-25-22(21(18)28-19)27-17-10-6-9-16(20(17)23)15-7-4-3-5-8-15/h3-11,13,24H,2,12,14H2,1H3,(H,25,27) |
| InChIKey | FJFPSFYLKCITFW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|