About 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile
4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile (PubChem CID 146341594) has the molecular formula C8H8FN
and a molecular weight of 137.16 g/mol. Its IUPAC name is 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile.
Analyze 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile (CID 146341594) is 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile is CC1CC(F)=CC=C1C#N.
What is the InChIKey of 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is QWFVHNDLBOAJAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN/c1-6-4-8(9)3-2-7(6)5-10/h2-3,6H,4H2,1H3.
What are the key properties of 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile?
4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 137.16 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-6-methylcyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 146341594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).