C17H17N5O3S — CID 146344698
7-(3-ethenylazetidin-1-yl)-5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-2,3-dihydro-1,8-naphthyridine-3-carboxylic acid (PubChem CID 146344698) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 7-(3-ethenylazetidin-1-yl)-5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-2,3-dihydro-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-(3-ethenylazetidin-1-yl)-5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-2,3-dihydro-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 146344698 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 7-(3-ethenylazetidin-1-yl)-5-methyl-4-oxo-1-(1,2,4-thiadiazol-5-yl)-2,3-dihydro-1,8-naphthyridine-3-carboxylic acid |
| SMILES | C=CC1CN(c2cc(C)c3c(n2)N(c2ncns2)CC(C(=O)O)C3=O)C1 |
| InChI | InChI=1S/C17H17N5O3S/c1-3-10-5-21(6-10)12-4-9(2)13-14(23)11(16(24)25)7-22(15(13)20-12)17-18-8-19-26-17/h3-4,8,10-11H,1,5-7H2,2H3,(H,24,25) |
| InChIKey | NTTADWAGQXSEJG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|