C18H19ClN2OS — CID 146346002
4-chloro-N-[4-(3-sulfanylpiperidin-1-yl)phenyl]benzamide (PubChem CID 146346002) has the molecular formula C18H19ClN2OS and a molecular weight of 346.88 g/mol. Its IUPAC name is 4-chloro-N-[4-(3-sulfanylpiperidin-1-yl)phenyl]benzamide.
| Compound Name | 4-chloro-N-[4-(3-sulfanylpiperidin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 146346002 |
| Molecular Formula | C18H19ClN2OS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-chloro-N-[4-(3-sulfanylpiperidin-1-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC(S)C2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2OS/c19-14-5-3-13(4-6-14)18(22)20-15-7-9-16(10-8-15)21-11-1-2-17(23)12-21/h3-10,17,23H,1-2,11-12H2,(H,20,22) |
| InChIKey | CSMKPHKSRPVLPO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|