C26H28F4N6O5 — CID 146348071
[7-(dimethylamino)-1-[[1-[[6-fluoro-7-(3,3,3-trifluoropropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamic acid (PubChem CID 146348071) has the molecular formula C26H28F4N6O5 and a molecular weight of 580.54 g/mol. Its IUPAC name is [7-(dimethylamino)-1-[[1-[[6-fluoro-7-(3,3,3-trifluoropropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamic acid.
| Compound Name | [7-(dimethylamino)-1-[[1-[[6-fluoro-7-(3,3,3-trifluoropropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamic acid |
|---|---|
| PubChem CID | 146348071 |
| Molecular Formula | C26H28F4N6O5 |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | [7-(dimethylamino)-1-[[1-[[6-fluoro-7-(3,3,3-trifluoropropyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]methyl]-2-oxo-3-pyridinyl]amino]-1,7-dioxohept-5-en-2-yl]carbamic acid |
| SMILES | CN(C)C(=O)C=CCCC(NC(=O)O)C(=O)Nc1cccn(Cc2cc3ncc(F)c(CCC(F)(F)F)c3[nH]2)c1=O |
| InChI | InChI=1S/C26H28F4N6O5/c1-35(2)21(37)8-4-3-6-18(34-25(40)41)23(38)33-19-7-5-11-36(24(19)39)14-15-12-20-22(32-15)16(17(27)13-31-20)9-10-26(28,29)30/h4-5,7-8,11-13,18,32,34H,3,6,9-10,14H2,1-2H3,(H,33,38)(H,40,41) |
| InChIKey | BXUKWOZOTAKXPP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 149.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|