C18H30BrN — CID 14634836
1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-prop-2-enylpiperidin-1-ium bromide (PubChem CID 14634836) has the molecular formula C18H30BrN and a molecular weight of 340.35 g/mol. Its IUPAC name is 1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-prop-2-enylpiperidin-1-ium bromide.
| Compound Name | 1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-prop-2-enylpiperidin-1-ium bromide |
|---|---|
| PubChem CID | 14634836 |
| Molecular Formula | C18H30BrN |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-1-prop-2-enylpiperidin-1-ium bromide |
| SMILES | C=CC[N+]1(CC2=CCC3CC2C3(C)C)CCCCC1.[Br-] |
| InChI | InChI=1S/C18H30N.BrH/c1-4-10-19(11-6-5-7-12-19)14-15-8-9-16-13-17(15)18(16,2)3;/h4,8,16-17H,1,5-7,9-14H2,2-3H3;1H/q+1;/p-1 |
| InChIKey | ZKWKFNVFQWPPKL-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|