C22H24F2N4O5 — CID 146349576
tert-butyl 5,7-difluoro-4-(2-methylpropyl)-2-[(3-nitro-2-oxo-1-pyridinyl)methyl]benzimidazole-1-carboxylate (PubChem CID 146349576) has the molecular formula C22H24F2N4O5 and a molecular weight of 462.45 g/mol. Its IUPAC name is tert-butyl 5,7-difluoro-4-(2-methylpropyl)-2-[(3-nitro-2-oxo-1-pyridinyl)methyl]benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 5,7-difluoro-4-(2-methylpropyl)-2-[(3-nitro-2-oxo-1-pyridinyl)methyl]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 146349576 |
| Molecular Formula | C22H24F2N4O5 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | tert-butyl 5,7-difluoro-4-(2-methylpropyl)-2-[(3-nitro-2-oxo-1-pyridinyl)methyl]benzimidazole-1-carboxylate |
| SMILES | CC(C)Cc1c(F)cc(F)c2c1nc(Cn1cccc([N+](=O)[O-])c1=O)n2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H24F2N4O5/c1-12(2)9-13-14(23)10-15(24)19-18(13)25-17(27(19)21(30)33-22(3,4)5)11-26-8-6-7-16(20(26)29)28(31)32/h6-8,10,12H,9,11H2,1-5H3 |
| InChIKey | IYOBIQZIRILOSN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 109.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|