C16H21N3O4 — CID 138559634
tert-butyl 4-(2-methylpropyl)-5-nitrobenzimidazole-1-carboxylate (PubChem CID 138559634) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is tert-butyl 4-(2-methylpropyl)-5-nitrobenzimidazole-1-carboxylate.
| Compound Name | tert-butyl 4-(2-methylpropyl)-5-nitrobenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 138559634 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | tert-butyl 4-(2-methylpropyl)-5-nitrobenzimidazole-1-carboxylate |
| SMILES | CC(C)Cc1c([N+](=O)[O-])ccc2c1ncn2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H21N3O4/c1-10(2)8-11-12(19(21)22)6-7-13-14(11)17-9-18(13)15(20)23-16(3,4)5/h6-7,9-10H,8H2,1-5H3 |
| InChIKey | UIORTDVCQICBJK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|