C22H22Cl3N7O12P2 — CID 146352179
8-(6-aminopurin-9-yl)-3,11-dihydroxy-3,11-dioxo-16-(2,5,6-trichlorobenzimidazol-1-yl)-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecane-17,18-diol (PubChem CID 146352179) has the molecular formula C22H22Cl3N7O12P2 and a molecular weight of 744.76 g/mol. Its IUPAC name is 8-(6-aminopurin-9-yl)-3,11-dihydroxy-3,11-dioxo-16-(2,5,6-trichlorobenzimidazol-1-yl)-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecane-17,18-diol.
| Compound Name | 8-(6-aminopurin-9-yl)-3,11-dihydroxy-3,11-dioxo-16-(2,5,6-trichlorobenzimidazol-1-yl)-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecane-17,18-diol |
|---|---|
| PubChem CID | 146352179 |
| Molecular Formula | C22H22Cl3N7O12P2 |
| Molecular Weight | 744.76 g/mol |
| Exact Mass | 742.99 |
| IUPAC Name | 8-(6-aminopurin-9-yl)-3,11-dihydroxy-3,11-dioxo-16-(2,5,6-trichlorobenzimidazol-1-yl)-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecane-17,18-diol |
| SMILES | Nc1ncnc2c1ncn2C1OC2COP(=O)(O)OC3C(O)C(COP(=O)(O)OC1C2O)OC3n1c(Cl)nc2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C22H22Cl3N7O12P2/c23-7-1-9-10(2-8(7)24)32(22(25)30-9)21-17-15(34)12(42-21)4-40-45(35,36)43-16-14(33)11(3-39-46(37,38)44-17)41-20(16)31-6-29-13-18(26)27-5-28-19(13)31/h1-2,5-6,11-12,14-17,20-21,33-34H,3-4H2,(H,35,36)(H,37,38)(H2,26,27,28) |
| InChIKey | QJWQGDJZOFSKME-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 257.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.76 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|