C22H21Cl3FN7O11P2 — CID 146352191
17-(6-aminopurin-9-yl)-18-fluoro-3,12-dihydroxy-3,12-dioxo-8-(2,5,6-trichlorobenzimidazol-1-yl)-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-9-ol (PubChem CID 146352191) has the molecular formula C22H21Cl3FN7O11P2 and a molecular weight of 746.75 g/mol. Its IUPAC name is 17-(6-aminopurin-9-yl)-18-fluoro-3,12-dihydroxy-3,12-dioxo-8-(2,5,6-trichlorobenzimidazol-1-yl)-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-9-ol.
| Compound Name | 17-(6-aminopurin-9-yl)-18-fluoro-3,12-dihydroxy-3,12-dioxo-8-(2,5,6-trichlorobenzimidazol-1-yl)-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-9-ol |
|---|---|
| PubChem CID | 146352191 |
| Molecular Formula | C22H21Cl3FN7O11P2 |
| Molecular Weight | 746.75 g/mol |
| Exact Mass | 744.98 |
| IUPAC Name | 17-(6-aminopurin-9-yl)-18-fluoro-3,12-dihydroxy-3,12-dioxo-8-(2,5,6-trichlorobenzimidazol-1-yl)-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.3.0.06,10]octadecan-9-ol |
| SMILES | Nc1ncnc2c1ncn2C1OC2COP(=O)(O)OC3C(COP(=O)(O)OC2C1F)OC(n1c(Cl)nc2cc(Cl)c(Cl)cc21)C3O |
| InChI | InChI=1S/C22H21Cl3FN7O11P2/c23-7-1-9-10(2-8(7)24)33(22(25)31-9)21-15(34)17-12(42-21)4-40-45(35,36)43-16-11(3-39-46(37,38)44-17)41-20(13(16)26)32-6-30-14-18(27)28-5-29-19(14)32/h1-2,5-6,11-13,15-17,20-21,34H,3-4H2,(H,35,36)(H,37,38)(H2,27,28,29) |
| InChIKey | JSTMAPKWGPODGH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 237.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.75 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|