C10H13FN2S — CID 146355778
(Z)-3-fluoro-4-[(2-methyl-3-pyridinyl)sulfanyl]but-2-en-1-amine (PubChem CID 146355778) has the molecular formula C10H13FN2S and a molecular weight of 212.29 g/mol. Its IUPAC name is (Z)-3-fluoro-4-[(2-methyl-3-pyridinyl)sulfanyl]but-2-en-1-amine.
| Compound Name | (Z)-3-fluoro-4-[(2-methyl-3-pyridinyl)sulfanyl]but-2-en-1-amine |
|---|---|
| PubChem CID | 146355778 |
| Molecular Formula | C10H13FN2S |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (Z)-3-fluoro-4-[(2-methyl-3-pyridinyl)sulfanyl]but-2-en-1-amine |
| SMILES | Cc1ncccc1SC/C(F)=C/CN |
| InChI | InChI=1S/C10H13FN2S/c1-8-10(3-2-6-13-8)14-7-9(11)4-5-12/h2-4,6H,5,7,12H2,1H3/b9-4- |
| InChIKey | BGUNLBGNIJFFPB-WTKPLQERSA-N |
| XLogP | 2.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |