C19H20N2O4 — CID 146358742
1-O-benzyl 2-O-[(2E,4E)-2-ethenyl-5-(ethenylamino)-6-iminohexa-2,4-dienyl] oxalate (PubChem CID 146358742) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-O-benzyl 2-O-[(2E,4E)-2-ethenyl-5-(ethenylamino)-6-iminohexa-2,4-dienyl] oxalate.
| Compound Name | 1-O-benzyl 2-O-[(2E,4E)-2-ethenyl-5-(ethenylamino)-6-iminohexa-2,4-dienyl] oxalate |
|---|---|
| PubChem CID | 146358742 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-O-benzyl 2-O-[(2E,4E)-2-ethenyl-5-(ethenylamino)-6-iminohexa-2,4-dienyl] oxalate |
| SMILES | [H]/N=C/C(=C\C=C(/C=C)COC(=O)C(=O)OCc1ccccc1)NC=C |
| InChI | InChI=1S/C19H20N2O4/c1-3-15(10-11-17(12-20)21-4-2)13-24-18(22)19(23)25-14-16-8-6-5-7-9-16/h3-12,20-21H,1-2,13-14H2/b15-10+,17-11+,20-12+ |
| InChIKey | XMZAVLRXPCJILY-FJKUFMDWSA-N |
| XLogP | 2.65 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|