C21H32N3O6P — CID 146359458
tert-butyl 4-benzoyloxy-3-[methoxy(methyl)carbamoyl]-5-methyl-5-phosphanyl-1,4-diazepane-1-carboxylate (PubChem CID 146359458) has the molecular formula C21H32N3O6P and a molecular weight of 453.48 g/mol. Its IUPAC name is tert-butyl 4-benzoyloxy-3-[methoxy(methyl)carbamoyl]-5-methyl-5-phosphanyl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-benzoyloxy-3-[methoxy(methyl)carbamoyl]-5-methyl-5-phosphanyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 146359458 |
| Molecular Formula | C21H32N3O6P |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | tert-butyl 4-benzoyloxy-3-[methoxy(methyl)carbamoyl]-5-methyl-5-phosphanyl-1,4-diazepane-1-carboxylate |
| SMILES | CON(C)C(=O)C1CN(C(=O)OC(C)(C)C)CCC(C)(P)N1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H32N3O6P/c1-20(2,3)29-19(27)23-13-12-21(4,31)24(16(14-23)17(25)22(5)28-6)30-18(26)15-10-8-7-9-11-15/h7-11,16H,12-14,31H2,1-6H3 |
| InChIKey | PHCQWRWTYSJUOL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|