C10H19N — CID 146360767
(1Z,3Z)-5-methyl-3-propylhexa-1,3-dien-1-amine (PubChem CID 146360767) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (1Z,3Z)-5-methyl-3-propylhexa-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-methyl-3-propylhexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 146360767 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (1Z,3Z)-5-methyl-3-propylhexa-1,3-dien-1-amine |
| SMILES | CCCC(/C=C\N)=C/C(C)C |
| InChI | InChI=1S/C10H19N/c1-4-5-10(6-7-11)8-9(2)3/h6-9H,4-5,11H2,1-3H3/b7-6-,10-8- |
| InChIKey | JAPHDFQIZCANGP-INZNQPOWSA-N |
| XLogP | 2.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|