C21H23F2N5OS — CID 146364502
3-amino-N-[(2S)-6-(2-aminoethylamino)-5,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 146364502) has the molecular formula C21H23F2N5OS and a molecular weight of 431.51 g/mol. Its IUPAC name is 3-amino-N-[(2S)-6-(2-aminoethylamino)-5,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(2S)-6-(2-aminoethylamino)-5,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146364502 |
| Molecular Formula | C21H23F2N5OS |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-amino-N-[(2S)-6-(2-aminoethylamino)-5,8-difluoro-1,2,3,4-tetrahydronaphthalen-2-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc2c(N)c(C(=O)N[C@H]3CCc4c(F)c(NCCN)cc(F)c4C3)sc2n1 |
| InChI | InChI=1S/C21H23F2N5OS/c1-10-2-4-13-18(25)19(30-21(13)27-10)20(29)28-11-3-5-12-14(8-11)15(22)9-16(17(12)23)26-7-6-24/h2,4,9,11,26H,3,5-8,24-25H2,1H3,(H,28,29)/t11-/m0/s1 |
| InChIKey | LAZUNOJBDPFMKT-NSHDSACASA-N |
| XLogP | 3.12 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |