C26H29FN6O2S — CID 166797086
3-amino-N-[(2R)-5-cyano-8-fluoro-6-(6-methoxy-1,4-diazepan-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 166797086) has the molecular formula C26H29FN6O2S and a molecular weight of 508.62 g/mol. Its IUPAC name is 3-amino-N-[(2R)-5-cyano-8-fluoro-6-(6-methoxy-1,4-diazepan-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(2R)-5-cyano-8-fluoro-6-(6-methoxy-1,4-diazepan-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166797086 |
| Molecular Formula | C26H29FN6O2S |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 3-amino-N-[(2R)-5-cyano-8-fluoro-6-(6-methoxy-1,4-diazepan-1-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | COC1CNCCN(c2cc(F)c3c(c2C#N)CC[C@@H](NC(=O)c2sc4nc(C)ccc4c2N)C3)C1 |
| InChI | InChI=1S/C26H29FN6O2S/c1-14-3-5-18-23(29)24(36-26(18)31-14)25(34)32-15-4-6-17-19(9-15)21(27)10-22(20(17)11-28)33-8-7-30-12-16(13-33)35-2/h3,5,10,15-16,30H,4,6-9,12-13,29H2,1-2H3,(H,32,34)/t15-,16?/m1/s1 |
| InChIKey | AFSCXNSYTLLYAX-AAFJCEBUSA-N |
| XLogP | 2.91 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |