C27H28N6O3S — CID 146349389
3-[(6R)-6-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-1-cyano-5,6,7,8-tetrahydronaphthalen-2-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid (PubChem CID 146349389) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is 3-[(6R)-6-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-1-cyano-5,6,7,8-tetrahydronaphthalen-2-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid.
| Compound Name | 3-[(6R)-6-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-1-cyano-5,6,7,8-tetrahydronaphthalen-2-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
|---|---|
| PubChem CID | 146349389 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 3-[(6R)-6-[(3-amino-6-methylthieno[2,3-b]pyridine-2-carbonyl)amino]-1-cyano-5,6,7,8-tetrahydronaphthalen-2-yl]-3,8-diazabicyclo[3.2.1]octane-8-carboxylic acid |
| SMILES | Cc1ccc2c(N)c(C(=O)N[C@@H]3CCc4c(ccc(N5CC6CCC(C5)N6C(=O)O)c4C#N)C3)sc2n1 |
| InChI | InChI=1S/C27H28N6O3S/c1-14-2-7-20-23(29)24(37-26(20)30-14)25(34)31-16-4-8-19-15(10-16)3-9-22(21(19)11-28)32-12-17-5-6-18(13-32)33(17)27(35)36/h2-3,7,9,16-18H,4-6,8,10,12-13,29H2,1H3,(H,31,34)(H,35,36)/t16-,17?,18?/m1/s1 |
| InChIKey | WBSHOYCEUWCNCD-WWDZGPRUSA-N |
| XLogP | 3.68 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |