C26H28N6OS — CID 167552543
7-amino-N-[(2R)-6-(3-azabicyclo[3.2.1]octan-3-yl)-5-cyano-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide (PubChem CID 167552543) has the molecular formula C26H28N6OS and a molecular weight of 472.62 g/mol. Its IUPAC name is 7-amino-N-[(2R)-6-(3-azabicyclo[3.2.1]octan-3-yl)-5-cyano-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide.
| Compound Name | 7-amino-N-[(2R)-6-(3-azabicyclo[3.2.1]octan-3-yl)-5-cyano-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 167552543 |
| Molecular Formula | C26H28N6OS |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 7-amino-N-[(2R)-6-(3-azabicyclo[3.2.1]octan-3-yl)-5-cyano-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide |
| SMILES | Cc1cnc2c(N)c(C(=O)N[C@@H]3CCc4c(ccc(N5CC6CCC(C6)C5)c4C#N)C3)sc2n1 |
| InChI | InChI=1S/C26H28N6OS/c1-14-11-29-23-22(28)24(34-26(23)30-14)25(33)31-18-5-6-19-17(9-18)4-7-21(20(19)10-27)32-12-15-2-3-16(8-15)13-32/h4,7,11,15-16,18H,2-3,5-6,8-9,12-13,28H2,1H3,(H,31,33)/t15?,16?,18-/m1/s1 |
| InChIKey | GZEUZXPWKJAAKX-LEOMRAHMSA-N |
| XLogP | 3.98 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |