C25H30N6OS — CID 137489689
7-amino-3-methyl-N-[(2S)-6-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide (PubChem CID 137489689) has the molecular formula C25H30N6OS and a molecular weight of 462.62 g/mol. Its IUPAC name is 7-amino-3-methyl-N-[(2S)-6-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide.
| Compound Name | 7-amino-3-methyl-N-[(2S)-6-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 137489689 |
| Molecular Formula | C25H30N6OS |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 7-amino-3-methyl-N-[(2S)-6-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide |
| SMILES | Cc1cnc2c(N)c(C(=O)N[C@H]3CCc4cc(N5CC6CCC(C5)N6C)ccc4C3)sc2n1 |
| InChI | InChI=1S/C25H30N6OS/c1-14-11-27-22-21(26)23(33-25(22)28-14)24(32)29-17-5-3-16-10-18(6-4-15(16)9-17)31-12-19-7-8-20(13-31)30(19)2/h4,6,10-11,17,19-20H,3,5,7-9,12-13,26H2,1-2H3,(H,29,32)/t17-,19?,20?/m0/s1 |
| InChIKey | OXCUVRVTXSMDLW-KKXNLOMOSA-N |
| XLogP | 3.15 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|