C22H26N6OS — CID 137489690
7-amino-3-methyl-N-[(2S)-6-piperazin-1-yl-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide (PubChem CID 137489690) has the molecular formula C22H26N6OS and a molecular weight of 422.56 g/mol. Its IUPAC name is 7-amino-3-methyl-N-[(2S)-6-piperazin-1-yl-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide.
| Compound Name | 7-amino-3-methyl-N-[(2S)-6-piperazin-1-yl-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 137489690 |
| Molecular Formula | C22H26N6OS |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 7-amino-3-methyl-N-[(2S)-6-piperazin-1-yl-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide |
| SMILES | Cc1cnc2c(N)c(C(=O)N[C@H]3CCc4cc(N5CCNCC5)ccc4C3)sc2n1 |
| InChI | InChI=1S/C22H26N6OS/c1-13-12-25-19-18(23)20(30-22(19)26-13)21(29)27-16-4-2-15-11-17(5-3-14(15)10-16)28-8-6-24-7-9-28/h3,5,11-12,16,24H,2,4,6-10,23H2,1H3,(H,27,29)/t16-/m0/s1 |
| InChIKey | BEUGTOFQJAZYEX-INIZCTEOSA-N |
| XLogP | 2.28 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|