C23H26N6OS — CID 146364680
7-amino-N-[(2S)-6-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide (PubChem CID 146364680) has the molecular formula C23H26N6OS and a molecular weight of 434.57 g/mol. Its IUPAC name is 7-amino-N-[(2S)-6-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide.
| Compound Name | 7-amino-N-[(2S)-6-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 146364680 |
| Molecular Formula | C23H26N6OS |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 7-amino-N-[(2S)-6-[(1S,4S)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide |
| SMILES | Cc1cnc2c(N)c(C(=O)N[C@H]3CCc4cc(N5C[C@@H]6C[C@H]5CN6)ccc4C3)sc2n1 |
| InChI | InChI=1S/C23H26N6OS/c1-12-9-26-20-19(24)21(31-23(20)27-12)22(30)28-15-4-2-14-7-17(5-3-13(14)6-15)29-11-16-8-18(29)10-25-16/h3,5,7,9,15-16,18,25H,2,4,6,8,10-11,24H2,1H3,(H,28,30)/t15-,16-,18-/m0/s1 |
| InChIKey | GLUUPUBNYKECQD-BQFCYCMXSA-N |
| XLogP | 2.42 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|