C23H28N6O2S — CID 137489623
7-amino-N-[(2R)-6-[(6R)-6-hydroxy-1,4-diazepan-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide (PubChem CID 137489623) has the molecular formula C23H28N6O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is 7-amino-N-[(2R)-6-[(6R)-6-hydroxy-1,4-diazepan-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide.
| Compound Name | 7-amino-N-[(2R)-6-[(6R)-6-hydroxy-1,4-diazepan-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 137489623 |
| Molecular Formula | C23H28N6O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 7-amino-N-[(2R)-6-[(6R)-6-hydroxy-1,4-diazepan-1-yl]-1,2,3,4-tetrahydronaphthalen-2-yl]-3-methylthieno[2,3-b]pyrazine-6-carboxamide |
| SMILES | Cc1cnc2c(N)c(C(=O)N[C@@H]3CCc4cc(N5CCNC[C@@H](O)C5)ccc4C3)sc2n1 |
| InChI | InChI=1S/C23H28N6O2S/c1-13-10-26-20-19(24)21(32-23(20)27-13)22(31)28-16-4-2-15-9-17(5-3-14(15)8-16)29-7-6-25-11-18(30)12-29/h3,5,9-10,16,18,25,30H,2,4,6-8,11-12,24H2,1H3,(H,28,31)/t16-,18-/m1/s1 |
| InChIKey | FRVWPSTULLPHKS-SJLPKXTDSA-N |
| XLogP | 1.64 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|