C24H28N6O2S — CID 142528435
7-amino-3-methyl-N-[6-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide (PubChem CID 142528435) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is 7-amino-3-methyl-N-[6-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide.
| Compound Name | 7-amino-3-methyl-N-[6-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide |
|---|---|
| PubChem CID | 142528435 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 7-amino-3-methyl-N-[6-(9-oxa-3,7-diazabicyclo[3.3.1]nonan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]thieno[2,3-b]pyrazine-6-carboxamide |
| SMILES | Cc1cnc2c(N)c(C(=O)NC3CCc4cc(N5CC6CNCC(C5)O6)ccc4C3)sc2n1 |
| InChI | InChI=1S/C24H28N6O2S/c1-13-8-27-21-20(25)22(33-24(21)28-13)23(31)29-16-4-2-15-7-17(5-3-14(15)6-16)30-11-18-9-26-10-19(12-30)32-18/h3,5,7-8,16,18-19,26H,2,4,6,9-12,25H2,1H3,(H,29,31) |
| InChIKey | JEVPVENXSWEUOW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|