C25H28FN5OS — CID 151133422
3-amino-N-[(2R)-6-(3,8-diazabicyclo[3.2.1]octan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-5-fluoro-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 151133422) has the molecular formula C25H28FN5OS and a molecular weight of 465.60 g/mol. Its IUPAC name is 3-amino-N-[(2R)-6-(3,8-diazabicyclo[3.2.1]octan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-5-fluoro-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(2R)-6-(3,8-diazabicyclo[3.2.1]octan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-5-fluoro-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 151133422 |
| Molecular Formula | C25H28FN5OS |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 3-amino-N-[(2R)-6-(3,8-diazabicyclo[3.2.1]octan-3-yl)-1,2,3,4-tetrahydronaphthalen-2-yl]-5-fluoro-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1nc2sc(C(=O)N[C@@H]3CCc4cc(N5CC6CCC(C5)N6)ccc4C3)c(N)c2cc1F |
| InChI | InChI=1S/C25H28FN5OS/c1-13-21(26)10-20-22(27)23(33-25(20)28-13)24(32)30-16-4-2-15-9-19(7-3-14(15)8-16)31-11-17-5-6-18(12-31)29-17/h3,7,9-10,16-18,29H,2,4-6,8,11-12,27H2,1H3,(H,30,32)/t16-,17?,18?/m1/s1 |
| InChIKey | MUSCUQNLCPREJW-WWDZGPRUSA-N |
| XLogP | 3.55 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|