C13H23N3 — CID 146367004
(3E)-4-(ethylideneamino)-2-imino-6,7-dimethylnona-3,8-dien-3-amine (PubChem CID 146367004) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is (3E)-4-(ethylideneamino)-2-imino-6,7-dimethylnona-3,8-dien-3-amine.
| Compound Name | (3E)-4-(ethylideneamino)-2-imino-6,7-dimethylnona-3,8-dien-3-amine |
|---|---|
| PubChem CID | 146367004 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | (3E)-4-(ethylideneamino)-2-imino-6,7-dimethylnona-3,8-dien-3-amine |
| SMILES | [H]/N=C(C)/C(N)=C(CC(C)C(C)C=C)\N=C\C |
| InChI | InChI=1S/C13H23N3/c1-6-9(3)10(4)8-12(16-7-2)13(15)11(5)14/h6-7,9-10,14H,1,8,15H2,2-5H3/b13-12+,14-11+,16-7+ |
| InChIKey | RCJZJTHOPHMKJS-JCGWXVDJSA-N |
| XLogP | 3.14 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|