C13H22FN3 — CID 126598647
N-[(3E)-3-amino-2-imino-6,7-dimethylnona-3,8-dien-4-yl]ethanimidoyl fluoride (PubChem CID 126598647) has the molecular formula C13H22FN3 and a molecular weight of 239.34 g/mol. Its IUPAC name is N-[(3E)-3-amino-2-imino-6,7-dimethylnona-3,8-dien-4-yl]ethanimidoyl fluoride.
| Compound Name | N-[(3E)-3-amino-2-imino-6,7-dimethylnona-3,8-dien-4-yl]ethanimidoyl fluoride |
|---|---|
| PubChem CID | 126598647 |
| Molecular Formula | C13H22FN3 |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.18 |
| IUPAC Name | N-[(3E)-3-amino-2-imino-6,7-dimethylnona-3,8-dien-4-yl]ethanimidoyl fluoride |
| SMILES | [H]/N=C(C)/C(N)=C(CC(C)C(C)C=C)\N=C(/C)F |
| InChI | InChI=1S/C13H22FN3/c1-6-8(2)9(3)7-12(17-11(5)14)13(16)10(4)15/h6,8-9,15H,1,7,16H2,2-5H3/b13-12+,15-10+,17-11+ |
| InChIKey | FDPKDBMVTNCZNU-OCKJXOKZSA-N |
| XLogP | 3.43 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|