C11H22FN9 — CID 161421983
N-(1-aminoethylidene)-2-fluoroethanimidamide;1-N,3-N-bis(1-aminoethylidene)propanediimidamide (PubChem CID 161421983) has the molecular formula C11H22FN9 and a molecular weight of 299.36 g/mol. Its IUPAC name is N-(1-aminoethylidene)-2-fluoroethanimidamide;1-N,3-N-bis(1-aminoethylidene)propanediimidamide.
| Compound Name | N-(1-aminoethylidene)-2-fluoroethanimidamide;1-N,3-N-bis(1-aminoethylidene)propanediimidamide |
|---|---|
| PubChem CID | 161421983 |
| Molecular Formula | C11H22FN9 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-(1-aminoethylidene)-2-fluoroethanimidamide;1-N,3-N-bis(1-aminoethylidene)propanediimidamide |
| SMILES | [H]/N=C(CC(=N/[H])/N=C(\C)N)\N=C(/C)N.[H]/N=C(CF)/N=C(\C)N |
| InChI | InChI=1S/C7H14N6.C4H8FN3/c1-4(8)12-6(10)3-7(11)13-5(2)9;1-3(6)8-4(7)2-5/h3H2,1-2H3,(H3,8,10,12)(H3,9,11,13);2H2,1H3,(H3,6,7,8) |
| InChIKey | VWVVCAVLEGKQMC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 186.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|