C6H9ClN4 — CID 168898427
(Z)-4-(1-aminoethylideneamino)-4-iminobut-2-enimidoyl chloride (PubChem CID 168898427) has the molecular formula C6H9ClN4 and a molecular weight of 172.62 g/mol. Its IUPAC name is (Z)-4-(1-aminoethylideneamino)-4-iminobut-2-enimidoyl chloride.
| Compound Name | (Z)-4-(1-aminoethylideneamino)-4-iminobut-2-enimidoyl chloride |
|---|---|
| PubChem CID | 168898427 |
| Molecular Formula | C6H9ClN4 |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | (Z)-4-(1-aminoethylideneamino)-4-iminobut-2-enimidoyl chloride |
| SMILES | [H]/N=C(Cl)/C=C\C(=N\[H])\N=C(/C)N |
| InChI | InChI=1S/C6H9ClN4/c1-4(8)11-6(10)3-2-5(7)9/h2-3,9H,1H3,(H3,8,10,11)/b3-2-,9-5- |
| InChIKey | ONBADAGMXJXVPR-RWFDEGICSA-N |
| XLogP | 1.11 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|