C10H11BrClN3O — CID 155722682
(Z,4E)-4-amino-4-(5-bromo-3-methoxy-1H-pyridin-2-ylidene)but-2-enimidoyl chloride (PubChem CID 155722682) has the molecular formula C10H11BrClN3O and a molecular weight of 304.58 g/mol. Its IUPAC name is (Z,4E)-4-amino-4-(5-bromo-3-methoxy-1H-pyridin-2-ylidene)but-2-enimidoyl chloride.
| Compound Name | (Z,4E)-4-amino-4-(5-bromo-3-methoxy-1H-pyridin-2-ylidene)but-2-enimidoyl chloride |
|---|---|
| PubChem CID | 155722682 |
| Molecular Formula | C10H11BrClN3O |
| Molecular Weight | 304.58 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | (Z,4E)-4-amino-4-(5-bromo-3-methoxy-1H-pyridin-2-ylidene)but-2-enimidoyl chloride |
| SMILES | [H]/N=C(Cl)/C=C\C(N)=C1/NC=C(Br)C=C1OC |
| InChI | InChI=1S/C10H11BrClN3O/c1-16-8-4-6(11)5-15-10(8)7(13)2-3-9(12)14/h2-5,14-15H,13H2,1H3/b3-2-,10-7+,14-9- |
| InChIKey | XHLPDJWUTALFHY-FKPAZZCHSA-N |
| XLogP | 2.30 |
| TPSA | 71.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|