C4H7Cl2N3 — CID 176924842
N'-[(Z)-2-amino-1,2-dichloroethenyl]ethanimidamide (PubChem CID 176924842) has the molecular formula C4H7Cl2N3 and a molecular weight of 168.03 g/mol. Its IUPAC name is N'-[(Z)-2-amino-1,2-dichloroethenyl]ethanimidamide.
| Compound Name | N'-[(Z)-2-amino-1,2-dichloroethenyl]ethanimidamide |
|---|---|
| PubChem CID | 176924842 |
| Molecular Formula | C4H7Cl2N3 |
| Molecular Weight | 168.03 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | N'-[(Z)-2-amino-1,2-dichloroethenyl]ethanimidamide |
| SMILES | C/C(N)=N/C(Cl)=C(\N)Cl |
| InChI | InChI=1S/C4H7Cl2N3/c1-2(7)9-4(6)3(5)8/h8H2,1H3,(H2,7,9)/b4-3- |
| InChIKey | YTSSNEGLDQTZLM-ARJAWSKDSA-N |
| XLogP | 0.93 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.03 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|