C15H26ClN3 — CID 126599350
N-[(3E)-2,3-diamino-6-methyl-7-propan-2-ylnona-1,3,8-trien-4-yl]ethanimidoyl chloride (PubChem CID 126599350) has the molecular formula C15H26ClN3 and a molecular weight of 283.85 g/mol. Its IUPAC name is N-[(3E)-2,3-diamino-6-methyl-7-propan-2-ylnona-1,3,8-trien-4-yl]ethanimidoyl chloride.
| Compound Name | N-[(3E)-2,3-diamino-6-methyl-7-propan-2-ylnona-1,3,8-trien-4-yl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 126599350 |
| Molecular Formula | C15H26ClN3 |
| Molecular Weight | 283.85 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N-[(3E)-2,3-diamino-6-methyl-7-propan-2-ylnona-1,3,8-trien-4-yl]ethanimidoyl chloride |
| SMILES | C=CC(C(C)C)C(C)CC(/N=C(\C)Cl)=C(\N)C(=C)N |
| InChI | InChI=1S/C15H26ClN3/c1-7-13(9(2)3)10(4)8-14(19-12(6)16)15(18)11(5)17/h7,9-10,13H,1,5,8,17-18H2,2-4,6H3/b15-14+,19-12+ |
| InChIKey | JRWGVZASLKFGBJ-CXOWERHOSA-N |
| XLogP | 3.77 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.85 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|