C7H11ClN4O — CID 174110642
N-[(E)-2,3-diamino-1-(ethenylamino)-3-oxoprop-1-enyl]ethanimidoyl chloride (PubChem CID 174110642) has the molecular formula C7H11ClN4O and a molecular weight of 202.65 g/mol. Its IUPAC name is N-[(E)-2,3-diamino-1-(ethenylamino)-3-oxoprop-1-enyl]ethanimidoyl chloride.
| Compound Name | N-[(E)-2,3-diamino-1-(ethenylamino)-3-oxoprop-1-enyl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 174110642 |
| Molecular Formula | C7H11ClN4O |
| Molecular Weight | 202.65 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | N-[(E)-2,3-diamino-1-(ethenylamino)-3-oxoprop-1-enyl]ethanimidoyl chloride |
| SMILES | C=CN/C(N=C(C)Cl)=C(\N)C(N)=O |
| InChI | InChI=1S/C7H11ClN4O/c1-3-11-7(12-4(2)8)5(9)6(10)13/h3,11H,1,9H2,2H3,(H2,10,13)/b7-5+,12-4? |
| InChIKey | IRYBATGFTZZMTH-GNRKCLAOSA-N |
| XLogP | -0.01 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.65 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|