C12H22N4 — CID 126593784
(2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide (PubChem CID 126593784) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide.
| Compound Name | (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide |
|---|---|
| PubChem CID | 126593784 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide |
| SMILES | [H]/N=C(N)/C(N)=C(CCCC(C)C=C)\N=C\C |
| InChI | InChI=1S/C12H22N4/c1-4-9(3)7-6-8-10(16-5-2)11(13)12(14)15/h4-5,9H,1,6-8,13H2,2-3H3,(H3,14,15)/b11-10+,16-5+ |
| InChIKey | IYWFWULIEPRUPB-QJDUYPNCSA-N |
| XLogP | 2.18 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|