About (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide
(2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide (PubChem CID 126593784) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide.
Molecular Properties
| Compound Name | (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide |
| PubChem CID | 126593784 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide |
| SMILES | [H]/N=C(N)/C(N)=C(CCCC(C)C=C)\N=C\C |
| InChI | InChI=1S/C12H22N4/c1-4-9(3)7-6-8-10(16-5-2)11(13)12(14)15/h4-5,9H,1,6-8,13H2,2-3H3,(H3,14,15)/b11-10+,16-5+ |
| InChIKey | IYWFWULIEPRUPB-QJDUYPNCSA-N |
| XLogP | 2.18 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide?
The IUPAC name of (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide (CID 126593784) is (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide.
What is the SMILES notation for (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide?
The canonical SMILES for (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide is [H]/N=C(N)/C(N)=C(CCCC(C)C=C)\N=C\C.
What is the InChIKey of (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide?
The InChIKey is IYWFWULIEPRUPB-QJDUYPNCSA-N. The full InChI is InChI=1S/C12H22N4/c1-4-9(3)7-6-8-10(16-5-2)11(13)12(14)15/h4-5,9H,1,6-8,13H2,2-3H3,(H3,14,15)/b11-10+,16-5+.
What are the key properties of (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide?
(2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide has a molecular weight of 222.34 g/mol, XLogP of 2.18, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-amino-3-(ethylideneamino)-7-methylnona-2,8-dienimidamide is sourced from PubChem (CID 126593784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).