C10H16ClF — CID 123281974
7-chloro-8-fluoro-3-methylnona-1,7-diene (PubChem CID 123281974) has the molecular formula C10H16ClF and a molecular weight of 190.69 g/mol. Its IUPAC name is 7-chloro-8-fluoro-3-methylnona-1,7-diene.
| Compound Name | 7-chloro-8-fluoro-3-methylnona-1,7-diene |
|---|---|
| PubChem CID | 123281974 |
| Molecular Formula | C10H16ClF |
| Molecular Weight | 190.69 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 7-chloro-8-fluoro-3-methylnona-1,7-diene |
| SMILES | C=CC(C)CCCC(Cl)=C(C)F |
| InChI | InChI=1S/C10H16ClF/c1-4-8(2)6-5-7-10(11)9(3)12/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | UHSCUUAJYIYTCP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.69 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|