C22H42O — CID 156702649
1-(2,6-dimethyloct-7-en-2-yloxy)-2-methylundec-1-ene (PubChem CID 156702649) has the molecular formula C22H42O and a molecular weight of 322.58 g/mol. Its IUPAC name is 1-(2,6-dimethyloct-7-en-2-yloxy)-2-methylundec-1-ene.
| Compound Name | 1-(2,6-dimethyloct-7-en-2-yloxy)-2-methylundec-1-ene |
|---|---|
| PubChem CID | 156702649 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | 1-(2,6-dimethyloct-7-en-2-yloxy)-2-methylundec-1-ene |
| SMILES | C=CC(C)CCCC(C)(C)OC=C(C)CCCCCCCCC |
| InChI | InChI=1S/C22H42O/c1-7-9-10-11-12-13-14-16-21(4)19-23-22(5,6)18-15-17-20(3)8-2/h8,19-20H,2,7,9-18H2,1,3-6H3 |
| InChIKey | PUGOMBPHJRODFF-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|