C18H34O — CID 144971934
(4E)-3,5-dimethyl-11-(2-methylbutan-2-yloxy)undeca-1,4-diene (PubChem CID 144971934) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is (4E)-3,5-dimethyl-11-(2-methylbutan-2-yloxy)undeca-1,4-diene.
| Compound Name | (4E)-3,5-dimethyl-11-(2-methylbutan-2-yloxy)undeca-1,4-diene |
|---|---|
| PubChem CID | 144971934 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | (4E)-3,5-dimethyl-11-(2-methylbutan-2-yloxy)undeca-1,4-diene |
| SMILES | C=CC(C)/C=C(\C)CCCCCCOC(C)(C)CC |
| InChI | InChI=1S/C18H34O/c1-7-16(3)15-17(4)13-11-9-10-12-14-19-18(5,6)8-2/h7,15-16H,1,8-14H2,2-6H3/b17-15+ |
| InChIKey | MAQYDJSWRXCLIE-BMRADRMJSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|