C53H34N4 — CID 146367825
4-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-diphenylfluoren-3-yl]benzonitrile (PubChem CID 146367825) has the molecular formula C53H34N4 and a molecular weight of 726.88 g/mol. Its IUPAC name is 4-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-diphenylfluoren-3-yl]benzonitrile.
| Compound Name | 4-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-diphenylfluoren-3-yl]benzonitrile |
|---|---|
| PubChem CID | 146367825 |
| Molecular Formula | C53H34N4 |
| Molecular Weight | 726.88 g/mol |
| Exact Mass | 726.28 |
| IUPAC Name | 4-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,9-diphenylfluoren-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc3c(cc2-c2cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C53H34N4/c54-35-36-28-30-37(31-29-36)45-33-47-44-26-13-14-27-48(44)53(42-22-9-3-10-23-42,43-24-11-4-12-25-43)49(47)34-46(45)40-20-15-21-41(32-40)52-56-50(38-16-5-1-6-17-38)55-51(57-52)39-18-7-2-8-19-39/h1-34H |
| InChIKey | XQEVHONIVNBMCJ-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.88 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |