C28H37ClN4O4S — CID 146368152
2-[5-(3-chlorophenyl)-2-oxopiperidin-1-yl]butanamide;2-(2-oxo-5-thiophen-3-ylpiperidin-1-yl)butanamide (PubChem CID 146368152) has the molecular formula C28H37ClN4O4S and a molecular weight of 561.15 g/mol. Its IUPAC name is 2-[5-(3-chlorophenyl)-2-oxopiperidin-1-yl]butanamide;2-(2-oxo-5-thiophen-3-ylpiperidin-1-yl)butanamide.
| Compound Name | 2-[5-(3-chlorophenyl)-2-oxopiperidin-1-yl]butanamide;2-(2-oxo-5-thiophen-3-ylpiperidin-1-yl)butanamide |
|---|---|
| PubChem CID | 146368152 |
| Molecular Formula | C28H37ClN4O4S |
| Molecular Weight | 561.15 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 2-[5-(3-chlorophenyl)-2-oxopiperidin-1-yl]butanamide;2-(2-oxo-5-thiophen-3-ylpiperidin-1-yl)butanamide |
| SMILES | CCC(C(N)=O)N1CC(c2cccc(Cl)c2)CCC1=O.CCC(C(N)=O)N1CC(c2ccsc2)CCC1=O |
| InChI | InChI=1S/C15H19ClN2O2.C13H18N2O2S/c1-2-13(15(17)20)18-9-11(6-7-14(18)19)10-4-3-5-12(16)8-10;1-2-11(13(14)17)15-7-9(3-4-12(15)16)10-5-6-18-8-10/h3-5,8,11,13H,2,6-7,9H2,1H3,(H2,17,20);5-6,8-9,11H,2-4,7H2,1H3,(H2,14,17) |
| InChIKey | MUCCJTXCZVVWCQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.15 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |