C20H24O — CID 14636851
(Z)-1,2-bis(2,4,6-trimethylphenyl)ethenol (PubChem CID 14636851) has the molecular formula C20H24O and a molecular weight of 280.41 g/mol. Its IUPAC name is (Z)-1,2-bis(2,4,6-trimethylphenyl)ethenol.
| Compound Name | (Z)-1,2-bis(2,4,6-trimethylphenyl)ethenol |
|---|---|
| PubChem CID | 14636851 |
| Molecular Formula | C20H24O |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (Z)-1,2-bis(2,4,6-trimethylphenyl)ethenol |
| SMILES | Cc1cc(C)c(/C=C(\O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C20H24O/c1-12-7-14(3)18(15(4)8-12)11-19(21)20-16(5)9-13(2)10-17(20)6/h7-11,21H,1-6H3/b19-11- |
| InChIKey | NPGYJHMKVMWUSU-ODLFYWEKSA-N |
| XLogP | 5.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|