C22H14I3NO4 — CID 146370620
(1,3-dioxo-6-propylbenzo[de]isoquinolin-2-yl) 2,3,6-triiodobenzoate (PubChem CID 146370620) has the molecular formula C22H14I3NO4 and a molecular weight of 737.07 g/mol. Its IUPAC name is (1,3-dioxo-6-propylbenzo[de]isoquinolin-2-yl) 2,3,6-triiodobenzoate.
| Compound Name | (1,3-dioxo-6-propylbenzo[de]isoquinolin-2-yl) 2,3,6-triiodobenzoate |
|---|---|
| PubChem CID | 146370620 |
| Molecular Formula | C22H14I3NO4 |
| Molecular Weight | 737.07 g/mol |
| Exact Mass | 736.81 |
| IUPAC Name | (1,3-dioxo-6-propylbenzo[de]isoquinolin-2-yl) 2,3,6-triiodobenzoate |
| SMILES | CCCc1ccc2c3c(cccc13)C(=O)N(OC(=O)c1c(I)ccc(I)c1I)C2=O |
| InChI | InChI=1S/C22H14I3NO4/c1-2-4-11-7-8-14-17-12(11)5-3-6-13(17)20(27)26(21(14)28)30-22(29)18-15(23)9-10-16(24)19(18)25/h3,5-10H,2,4H2,1H3 |
| InChIKey | YRWCRMSHBQQRHO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.07 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|