C27H24I3NO4 — CID 146370494
(6-octyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 2,3,6-triiodobenzoate (PubChem CID 146370494) has the molecular formula C27H24I3NO4 and a molecular weight of 807.20 g/mol. Its IUPAC name is (6-octyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 2,3,6-triiodobenzoate.
| Compound Name | (6-octyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 2,3,6-triiodobenzoate |
|---|---|
| PubChem CID | 146370494 |
| Molecular Formula | C27H24I3NO4 |
| Molecular Weight | 807.20 g/mol |
| Exact Mass | 806.88 |
| IUPAC Name | (6-octyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 2,3,6-triiodobenzoate |
| SMILES | CCCCCCCCc1ccc2c3c(cccc13)C(=O)N(OC(=O)c1c(I)ccc(I)c1I)C2=O |
| InChI | InChI=1S/C27H24I3NO4/c1-2-3-4-5-6-7-9-16-12-13-19-22-17(16)10-8-11-18(22)25(32)31(26(19)33)35-27(34)23-20(28)14-15-21(29)24(23)30/h8,10-15H,2-7,9H2,1H3 |
| InChIKey | CZLBQKFAYNREHU-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.20 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|