C22H27NO5S — CID 153301258
[6-(2-methylpropyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] hexane-1-sulfonate (PubChem CID 153301258) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is [6-(2-methylpropyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] hexane-1-sulfonate.
| Compound Name | [6-(2-methylpropyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] hexane-1-sulfonate |
|---|---|
| PubChem CID | 153301258 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [6-(2-methylpropyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] hexane-1-sulfonate |
| SMILES | CCCCCCS(=O)(=O)ON1C(=O)c2cccc3c(CC(C)C)ccc(c23)C1=O |
| InChI | InChI=1S/C22H27NO5S/c1-4-5-6-7-13-29(26,27)28-23-21(24)18-10-8-9-17-16(14-15(2)3)11-12-19(20(17)18)22(23)25/h8-12,15H,4-7,13-14H2,1-3H3 |
| InChIKey | NMTUHTGDYHJUEI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|