C23H25NO5S — CID 118490597
(6-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) bicyclo[2.2.1]heptane-2-sulfonate (PubChem CID 118490597) has the molecular formula C23H25NO5S and a molecular weight of 427.52 g/mol. Its IUPAC name is (6-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) bicyclo[2.2.1]heptane-2-sulfonate.
| Compound Name | (6-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) bicyclo[2.2.1]heptane-2-sulfonate |
|---|---|
| PubChem CID | 118490597 |
| Molecular Formula | C23H25NO5S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (6-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) bicyclo[2.2.1]heptane-2-sulfonate |
| SMILES | CCCCc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)C1CC3CCC1C3)C2=O |
| InChI | InChI=1S/C23H25NO5S/c1-2-3-5-15-10-11-19-21-17(15)6-4-7-18(21)22(25)24(23(19)26)29-30(27,28)20-13-14-8-9-16(20)12-14/h4,6-7,10-11,14,16,20H,2-3,5,8-9,12-13H2,1H3 |
| InChIKey | QCGCTUSXELNVSD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|