C22H24F3NO5S — CID 162608149
2-[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]oxy-6-octoxybenzo[de]isoquinoline-1,3-dione (PubChem CID 162608149) has the molecular formula C22H24F3NO5S and a molecular weight of 471.50 g/mol. Its IUPAC name is 2-[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]oxy-6-octoxybenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]oxy-6-octoxybenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 162608149 |
| Molecular Formula | C22H24F3NO5S |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 2-[methylidene-oxo-(trifluoromethyl)-λ6-sulfanyl]oxy-6-octoxybenzo[de]isoquinoline-1,3-dione |
| SMILES | C=S(=O)(ON1C(=O)c2cccc3c(OCCCCCCCC)ccc(c23)C1=O)C(F)(F)F |
| InChI | InChI=1S/C22H24F3NO5S/c1-3-4-5-6-7-8-14-30-18-13-12-17-19-15(18)10-9-11-16(19)20(27)26(21(17)28)31-32(2,29)22(23,24)25/h9-13H,2-8,14H2,1H3 |
| InChIKey | NTGAZJFHQDIZAC-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|