C31H37NO5S — CID 118490608
(6-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 118490608) has the molecular formula C31H37NO5S and a molecular weight of 535.71 g/mol. Its IUPAC name is (6-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | (6-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 118490608 |
| Molecular Formula | C31H37NO5S |
| Molecular Weight | 535.71 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | (6-butyl-1,3-dioxobenzo[de]isoquinolin-2-yl) 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CCCCc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C)C2=O |
| InChI | InChI=1S/C31H37NO5S/c1-8-9-11-21-14-15-25-28-23(21)12-10-13-24(28)30(33)32(31(25)34)37-38(35,36)29-26(19(4)5)16-22(18(2)3)17-27(29)20(6)7/h10,12-20H,8-9,11H2,1-7H3 |
| InChIKey | YXPGPBWQHBIXRY-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.71 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|